2,4-Dichlorophenol--Lianyungang Hengmao Chemicals Co.,Ltd.
Lianyungang Hengmao Chemicals Co.,Ltd.
 
 
 
 
 

2,4-Dichlorophenol
product Name
2,4-Dichlorophenol
Synonyms
2,4-DCP; 4,6-Dichlorophenol; Dichlorophenol, 2,4-DCP; 2,4-Dichloro-1-Hydroxy-Benzene; Dichlorophenol(2,4-); 1-Hydroxy-2,4-dichlorobenzene; 2,4-dichlorohydroxybenzene; 2,4-dichloro-pheno; 2,4-Dichloro phenol; 2,3-dichlorophenol; potassium 2,4-dichlorophenolate
Molecular Formula
C6H4Cl2O
Molecular Weight
163.00316
InChI
InChI:1S/C6H4Cl2O/c7-4-1-2-6(9)5(8)3-4/h1-3,9H
CAS Registry Number
120-83-2
EINECS
204-429-6
Molecular Structure
120-83-2 2,4-Dichlorophenol
 
Melting point
41-44℃

Assay

≥99%

Appearance

white crystal

Packing

250Kg galvanized drum or iron drum

Use

As pesticide or pharmaceutical intermediate